C18H19F3O5 — CID 137316145
methyl 5-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyhept-6-ynoate (PubChem CID 137316145) has the molecular formula C18H19F3O5 and a molecular weight of 372.34 g/mol. Its IUPAC name is methyl 5-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyhept-6-ynoate.
| Compound Name | methyl 5-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyhept-6-ynoate |
|---|---|
| PubChem CID | 137316145 |
| Molecular Formula | C18H19F3O5 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | methyl 5-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyhept-6-ynoate |
| SMILES | C#CC(CCCC(=O)OC)OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H19F3O5/c1-4-14(11-8-12-15(22)24-2)26-16(23)17(25-3,18(19,20)21)13-9-6-5-7-10-13/h1,5-7,9-10,14H,8,11-12H2,2-3H3/t14?,17-/m1/s1 |
| InChIKey | HIIRCCJIORYBQQ-FBMWCMRBSA-N |
| XLogP | 2.98 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|