C25H31N5O4 — CID 137316362
6-hydroxy-3-N,5-N-dimethyl-3-N-(2-methylpropyl)-5-N-(4-morpholin-4-ylphenyl)-1H-indazole-3,5-dicarboxamide (PubChem CID 137316362) has the molecular formula C25H31N5O4 and a molecular weight of 465.55 g/mol. Its IUPAC name is 6-hydroxy-3-N,5-N-dimethyl-3-N-(2-methylpropyl)-5-N-(4-morpholin-4-ylphenyl)-1H-indazole-3,5-dicarboxamide.
| Compound Name | 6-hydroxy-3-N,5-N-dimethyl-3-N-(2-methylpropyl)-5-N-(4-morpholin-4-ylphenyl)-1H-indazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 137316362 |
| Molecular Formula | C25H31N5O4 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 6-hydroxy-3-N,5-N-dimethyl-3-N-(2-methylpropyl)-5-N-(4-morpholin-4-ylphenyl)-1H-indazole-3,5-dicarboxamide |
| SMILES | CC(C)CN(C)C(=O)c1n[nH]c2cc(O)c(C(=O)N(C)c3ccc(N4CCOCC4)cc3)cc12 |
| InChI | InChI=1S/C25H31N5O4/c1-16(2)15-28(3)25(33)23-19-13-20(22(31)14-21(19)26-27-23)24(32)29(4)17-5-7-18(8-6-17)30-9-11-34-12-10-30/h5-8,13-14,16,31H,9-12,15H2,1-4H3,(H,26,27) |
| InChIKey | WGOODDGVJPEWGA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 102.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|