C24H28N4O3 — CID 136641484
[6-hydroxy-3-(2-methylpropyl)-2H-indazol-5-yl]-(5-morpholin-4-yl-1,3-dihydroisoindol-2-yl)methanone (PubChem CID 136641484) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is [6-hydroxy-3-(2-methylpropyl)-2H-indazol-5-yl]-(5-morpholin-4-yl-1,3-dihydroisoindol-2-yl)methanone.
| Compound Name | [6-hydroxy-3-(2-methylpropyl)-2H-indazol-5-yl]-(5-morpholin-4-yl-1,3-dihydroisoindol-2-yl)methanone |
|---|---|
| PubChem CID | 136641484 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | [6-hydroxy-3-(2-methylpropyl)-2H-indazol-5-yl]-(5-morpholin-4-yl-1,3-dihydroisoindol-2-yl)methanone |
| SMILES | CC(C)Cc1[nH]nc2cc(O)c(C(=O)N3Cc4ccc(N5CCOCC5)cc4C3)cc12 |
| InChI | InChI=1S/C24H28N4O3/c1-15(2)9-21-19-11-20(23(29)12-22(19)26-25-21)24(30)28-13-16-3-4-18(10-17(16)14-28)27-5-7-31-8-6-27/h3-4,10-12,15,29H,5-9,13-14H2,1-2H3,(H,25,26) |
| InChIKey | DZTRQZCWYAPUCA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 81.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|