C25H31N5O3 — CID 136655916
2-[6-hydroxy-3-(3-methylbutyl)-2H-indazole-5-carbonyl]-N-[2-(methylamino)ethyl]-1,3-dihydroisoindole-5-carboxamide (PubChem CID 136655916) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is 2-[6-hydroxy-3-(3-methylbutyl)-2H-indazole-5-carbonyl]-N-[2-(methylamino)ethyl]-1,3-dihydroisoindole-5-carboxamide.
| Compound Name | 2-[6-hydroxy-3-(3-methylbutyl)-2H-indazole-5-carbonyl]-N-[2-(methylamino)ethyl]-1,3-dihydroisoindole-5-carboxamide |
|---|---|
| PubChem CID | 136655916 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 2-[6-hydroxy-3-(3-methylbutyl)-2H-indazole-5-carbonyl]-N-[2-(methylamino)ethyl]-1,3-dihydroisoindole-5-carboxamide |
| SMILES | CNCCNC(=O)c1ccc2c(c1)CN(C(=O)c1cc3c(CCC(C)C)[nH]nc3cc1O)C2 |
| InChI | InChI=1S/C25H31N5O3/c1-15(2)4-7-21-19-11-20(23(31)12-22(19)29-28-21)25(33)30-13-17-6-5-16(10-18(17)14-30)24(32)27-9-8-26-3/h5-6,10-12,15,26,31H,4,7-9,13-14H2,1-3H3,(H,27,32)(H,28,29) |
| InChIKey | KETNTARNTLHTGV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|