C9H10ClF2NO — CID 137319852
3-(3,4-difluorophenyl)oxetan-3-amine;hydrochloride (PubChem CID 137319852) has the molecular formula C9H10ClF2NO and a molecular weight of 221.63 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)oxetan-3-amine;hydrochloride.
| Compound Name | 3-(3,4-difluorophenyl)oxetan-3-amine;hydrochloride |
|---|---|
| PubChem CID | 137319852 |
| Molecular Formula | C9H10ClF2NO |
| Molecular Weight | 221.63 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 3-(3,4-difluorophenyl)oxetan-3-amine;hydrochloride |
| SMILES | Cl.NC1(c2ccc(F)c(F)c2)COC1 |
| InChI | InChI=1S/C9H9F2NO.ClH/c10-7-2-1-6(3-8(7)11)9(12)4-13-5-9;/h1-3H,4-5,12H2;1H |
| InChIKey | GVEBGLXADADUNX-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.63 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |