C13H13F2NO — CID 116875499
2-[3-(3,4-difluorophenyl)oxetan-3-yl]butanenitrile (PubChem CID 116875499) has the molecular formula C13H13F2NO and a molecular weight of 237.25 g/mol. Its IUPAC name is 2-[3-(3,4-difluorophenyl)oxetan-3-yl]butanenitrile.
| Compound Name | 2-[3-(3,4-difluorophenyl)oxetan-3-yl]butanenitrile |
|---|---|
| PubChem CID | 116875499 |
| Molecular Formula | C13H13F2NO |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2-[3-(3,4-difluorophenyl)oxetan-3-yl]butanenitrile |
| SMILES | CCC(C#N)C1(c2ccc(F)c(F)c2)COC1 |
| InChI | InChI=1S/C13H13F2NO/c1-2-9(6-16)13(7-17-8-13)10-3-4-11(14)12(15)5-10/h3-5,9H,2,7-8H2,1H3 |
| InChIKey | FAKZVENTCSAWIA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |