C14H19F2NO — CID 116875600
2-[3-(3,4-difluorophenyl)oxetan-3-yl]-N-methylbutan-1-amine (PubChem CID 116875600) has the molecular formula C14H19F2NO and a molecular weight of 255.31 g/mol. Its IUPAC name is 2-[3-(3,4-difluorophenyl)oxetan-3-yl]-N-methylbutan-1-amine.
| Compound Name | 2-[3-(3,4-difluorophenyl)oxetan-3-yl]-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 116875600 |
| Molecular Formula | C14H19F2NO |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 2-[3-(3,4-difluorophenyl)oxetan-3-yl]-N-methylbutan-1-amine |
| SMILES | CCC(CNC)C1(c2ccc(F)c(F)c2)COC1 |
| InChI | InChI=1S/C14H19F2NO/c1-3-10(7-17-2)14(8-18-9-14)11-4-5-12(15)13(16)6-11/h4-6,10,17H,3,7-9H2,1-2H3 |
| InChIKey | LFADWBJXTJZXHP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |