C9H12F2N2 — CID 116932454
1-(3,4-difluorophenyl)-N'-methylethane-1,2-diamine (PubChem CID 116932454) has the molecular formula C9H12F2N2 and a molecular weight of 186.20 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-N'-methylethane-1,2-diamine.
| Compound Name | 1-(3,4-difluorophenyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 116932454 |
| Molecular Formula | C9H12F2N2 |
| Molecular Weight | 186.20 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 1-(3,4-difluorophenyl)-N'-methylethane-1,2-diamine |
| SMILES | CNCC(N)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C9H12F2N2/c1-13-5-9(12)6-2-3-7(10)8(11)4-6/h2-4,9,13H,5,12H2,1H3 |
| InChIKey | UCVAHULYVKAICA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |