C9H11ClO3 — CID 137319969
2-(3-chlorophenoxy)propane-1,3-diol (PubChem CID 137319969) has the molecular formula C9H11ClO3 and a molecular weight of 202.64 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)propane-1,3-diol.
| Compound Name | 2-(3-chlorophenoxy)propane-1,3-diol |
|---|---|
| PubChem CID | 137319969 |
| Molecular Formula | C9H11ClO3 |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 2-(3-chlorophenoxy)propane-1,3-diol |
| SMILES | OCC(CO)Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C9H11ClO3/c10-7-2-1-3-8(4-7)13-9(5-11)6-12/h1-4,9,11-12H,5-6H2 |
| InChIKey | HRBKRNYDHLKOOG-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |