About CID 137324353
CID 137324353 (PubChem CID 137324353) has the molecular formula C60H44N4O2
and a molecular weight of 853.04 g/mol.
Molecular Properties
| Compound Name | CID 137324353 |
| PubChem CID | 137324353 |
| Molecular Formula | C60H44N4O2 |
| Molecular Weight | 853.04 g/mol |
| Exact Mass | 852.35 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(C2=C3C=CC(=N3)[C@]3(C(=O)c4cccc5cccc3c45)c3ccc([nH]3)C(c3c(C)cc(C)cc3C)=C3C=CC(=N3)[C@]3(C(=O)c4cccc5cccc3c45)c3ccc2[nH]3)c(C)c1 |
| InChI | InChI=1S/C60H44N4O2/c1-31-27-33(3)51(34(4)28-31)55-43-19-23-47(61-43)59(41-17-9-13-37-11-7-15-39(53(37)41)57(59)65)49-25-21-45(63-49)56(52-35(5)29-32(2)30-36(52)6)46-22-26-50(64-46)60(48-24-20-44(55)62-48)42-18-10-14-38-12-8-16-40(54(38)42)58(60)66/h7-30,61,64H,1-6H3/t59-,60+/m1/s1 |
| InChIKey | XTTGGAQHOJSGCI-KHGQOBKHSA-N |
| XLogP | 12.72 |
| TPSA | 90.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 66 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 853.04 |
| LogP ≤ 5 | 12.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 137324353 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 137324353?
The IUPAC name of CID 137324353 (CID 137324353) is not available.
What is the SMILES notation for CID 137324353?
The canonical SMILES for CID 137324353 is Cc1cc(C)c(C2=C3C=CC(=N3)[C@]3(C(=O)c4cccc5cccc3c45)c3ccc([nH]3)C(c3c(C)cc(C)cc3C)=C3C=CC(=N3)[C@]3(C(=O)c4cccc5cccc3c45)c3ccc2[nH]3)c(C)c1.
What is the InChIKey of CID 137324353?
The InChIKey is XTTGGAQHOJSGCI-KHGQOBKHSA-N. The full InChI is InChI=1S/C60H44N4O2/c1-31-27-33(3)51(34(4)28-31)55-43-19-23-47(61-43)59(41-17-9-13-37-11-7-15-39(53(37)41)57(59)65)49-25-21-45(63-49)56(52-35(5)29-32(2)30-36(52)6)46-22-26-50(64-46)60(48-24-20-44(55)62-48)42-18-10-14-38-12-8-16-40(54(38)42)58(60)66/h7-30,61,64H,1-6H3/t59-,60+/m1/s1.
What are the key properties of CID 137324353?
CID 137324353 has a molecular weight of 853.04 g/mol, XLogP of 12.72, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 137324353 is sourced from PubChem (CID 137324353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).