C33H64O5Si3 — CID 137324616
methyl (3R)-3-[(3R,10S,12S,13R)-10,13-dimethyl-3,7,12-tris(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate (PubChem CID 137324616) has the molecular formula C33H64O5Si3 and a molecular weight of 625.13 g/mol. Its IUPAC name is methyl (3R)-3-[(3R,10S,12S,13R)-10,13-dimethyl-3,7,12-tris(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate.
| Compound Name | methyl (3R)-3-[(3R,10S,12S,13R)-10,13-dimethyl-3,7,12-tris(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate |
|---|---|
| PubChem CID | 137324616 |
| Molecular Formula | C33H64O5Si3 |
| Molecular Weight | 625.13 g/mol |
| Exact Mass | 624.41 |
| IUPAC Name | methyl (3R)-3-[(3R,10S,12S,13R)-10,13-dimethyl-3,7,12-tris(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate |
| SMILES | COC(=O)C[C@@H](C)C1CCC2C3C(O[Si](C)(C)C)CC4C[C@H](O[Si](C)(C)C)CC[C@]4(C)C3C[C@H](O[Si](C)(C)C)[C@@]21C |
| InChI | InChI=1S/C33H64O5Si3/c1-22(18-30(34)35-4)25-14-15-26-31-27(21-29(33(25,26)3)38-41(11,12)13)32(2)17-16-24(36-39(5,6)7)19-23(32)20-28(31)37-40(8,9)10/h22-29,31H,14-21H2,1-13H3/t22-,23?,24-,25?,26?,27?,28?,29+,31?,32+,33-/m1/s1 |
| InChIKey | IQRHCEGIECHWFO-YWOGMIGISA-N |
| XLogP | 8.72 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.13 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|