C16H27BrSi — CID 137329878
[2-(3-bromophenyl)-2,4,4-trimethylpentan-3-yl]-dimethylsilane (PubChem CID 137329878) has the molecular formula C16H27BrSi and a molecular weight of 327.38 g/mol. Its IUPAC name is [2-(3-bromophenyl)-2,4,4-trimethylpentan-3-yl]-dimethylsilane.
| Compound Name | [2-(3-bromophenyl)-2,4,4-trimethylpentan-3-yl]-dimethylsilane |
|---|---|
| PubChem CID | 137329878 |
| Molecular Formula | C16H27BrSi |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | [2-(3-bromophenyl)-2,4,4-trimethylpentan-3-yl]-dimethylsilane |
| SMILES | C[SiH](C)C(C(C)(C)C)C(C)(C)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H27BrSi/c1-15(2,3)14(18(6)7)16(4,5)12-9-8-10-13(17)11-12/h8-11,14,18H,1-7H3 |
| InChIKey | KICQNIRMPXTCQI-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|