C30H23NSi — CID 137330036
[4-(3,6-diphenylcarbazol-9-yl)phenyl]silane (PubChem CID 137330036) has the molecular formula C30H23NSi and a molecular weight of 425.61 g/mol. Its IUPAC name is [4-(3,6-diphenylcarbazol-9-yl)phenyl]silane.
| Compound Name | [4-(3,6-diphenylcarbazol-9-yl)phenyl]silane |
|---|---|
| PubChem CID | 137330036 |
| Molecular Formula | C30H23NSi |
| Molecular Weight | 425.61 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | [4-(3,6-diphenylcarbazol-9-yl)phenyl]silane |
| SMILES | [SiH3]c1ccc(-n2c3ccc(-c4ccccc4)cc3c3cc(-c4ccccc4)ccc32)cc1 |
| InChI | InChI=1S/C30H23NSi/c32-26-15-13-25(14-16-26)31-29-17-11-23(21-7-3-1-4-8-21)19-27(29)28-20-24(12-18-30(28)31)22-9-5-2-6-10-22/h1-20H,32H3 |
| InChIKey | UMBQLBYZQFYWFJ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.61 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|