C48H37NSSi — CID 137330558
phenyl-[7-(11,11,19,19-tetramethyl-15-azaheptacyclo[14.11.0.02,14.04,12.05,10.018,26.020,25]heptacosa-1(27),2,4(12),5,7,9,13,16,18(26),20,22,24-dodecaen-15-yl)dibenzothiophen-3-yl]silane (PubChem CID 137330558) has the molecular formula C48H37NSSi and a molecular weight of 687.98 g/mol. Its IUPAC name is phenyl-[7-(11,11,19,19-tetramethyl-15-azaheptacyclo[14.11.0.02,14.04,12.05,10.018,26.020,25]heptacosa-1(27),2,4(12),5,7,9,13,16,18(26),20,22,24-dodecaen-15-yl)dibenzothiophen-3-yl]silane.
| Compound Name | phenyl-[7-(11,11,19,19-tetramethyl-15-azaheptacyclo[14.11.0.02,14.04,12.05,10.018,26.020,25]heptacosa-1(27),2,4(12),5,7,9,13,16,18(26),20,22,24-dodecaen-15-yl)dibenzothiophen-3-yl]silane |
|---|---|
| PubChem CID | 137330558 |
| Molecular Formula | C48H37NSSi |
| Molecular Weight | 687.98 g/mol |
| Exact Mass | 687.24 |
| IUPAC Name | phenyl-[7-(11,11,19,19-tetramethyl-15-azaheptacyclo[14.11.0.02,14.04,12.05,10.018,26.020,25]heptacosa-1(27),2,4(12),5,7,9,13,16,18(26),20,22,24-dodecaen-15-yl)dibenzothiophen-3-yl]silane |
| SMILES | CC1(C)c2ccccc2-c2cc3c4cc5c(cc4n(-c4ccc6c(c4)sc4cc([SiH2]c7ccccc7)ccc46)c3cc21)C(C)(C)c1ccccc1-5 |
| InChI | InChI=1S/C48H37NSSi/c1-47(2)39-16-10-8-14-31(39)35-24-37-38-25-36-32-15-9-11-17-40(32)48(3,4)42(36)27-44(38)49(43(37)26-41(35)47)28-18-20-33-34-21-19-30(23-46(34)50-45(33)22-28)51-29-12-6-5-7-13-29/h5-27H,51H2,1-4H3 |
| InChIKey | BYAJZYAYAUCVJD-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.98 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|