C20H24F3NO4Si — CID 137330999
5-[2-(cyclopropylmethoxy)-5-[ethyl(hydroxy)silyl]phenyl]-1-methyl-3-(2,2,2-trifluoroethoxy)pyridin-2-one (PubChem CID 137330999) has the molecular formula C20H24F3NO4Si and a molecular weight of 427.50 g/mol. Its IUPAC name is 5-[2-(cyclopropylmethoxy)-5-[ethyl(hydroxy)silyl]phenyl]-1-methyl-3-(2,2,2-trifluoroethoxy)pyridin-2-one.
| Compound Name | 5-[2-(cyclopropylmethoxy)-5-[ethyl(hydroxy)silyl]phenyl]-1-methyl-3-(2,2,2-trifluoroethoxy)pyridin-2-one |
|---|---|
| PubChem CID | 137330999 |
| Molecular Formula | C20H24F3NO4Si |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 5-[2-(cyclopropylmethoxy)-5-[ethyl(hydroxy)silyl]phenyl]-1-methyl-3-(2,2,2-trifluoroethoxy)pyridin-2-one |
| SMILES | CC[SiH](O)c1ccc(OCC2CC2)c(-c2cc(OCC(F)(F)F)c(=O)n(C)c2)c1 |
| InChI | InChI=1S/C20H24F3NO4Si/c1-3-29(26)15-6-7-17(27-11-13-4-5-13)16(9-15)14-8-18(19(25)24(2)10-14)28-12-20(21,22)23/h6-10,13,26,29H,3-5,11-12H2,1-2H3 |
| InChIKey | KFHXDVPJONNKFX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|