C21H17F5NO3Si — CID 162614402
CID 162614402 (PubChem CID 162614402) has the molecular formula C21H17F5NO3Si and a molecular weight of 454.45 g/mol.
| Compound Name | CID 162614402 |
|---|---|
| PubChem CID | 162614402 |
| Molecular Formula | C21H17F5NO3Si |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | — |
| SMILES | CC[Si](O)c1ccc(Oc2ccc(F)cc2F)c(-c2cc(C(F)(F)F)c(=O)n(C)c2)c1 |
| InChI | InChI=1S/C21H17F5NO3Si/c1-3-31(29)14-5-7-18(30-19-6-4-13(22)9-17(19)23)15(10-14)12-8-16(21(24,25)26)20(28)27(2)11-12/h4-11,29H,3H2,1-2H3 |
| InChIKey | JLIRGWYIMGLWBA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|