About CID 162614402
CID 162614402 (PubChem CID 162614402) has the molecular formula C21H17F5NO3Si
and a molecular weight of 454.45 g/mol.
Molecular Properties
| Compound Name | CID 162614402 |
| PubChem CID | 162614402 |
| Molecular Formula | C21H17F5NO3Si |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | — |
| SMILES | CC[Si](O)c1ccc(Oc2ccc(F)cc2F)c(-c2cc(C(F)(F)F)c(=O)n(C)c2)c1 |
| InChI | InChI=1S/C21H17F5NO3Si/c1-3-31(29)14-5-7-18(30-19-6-4-13(22)9-17(19)23)15(10-14)12-8-16(21(24,25)26)20(28)27(2)11-12/h4-11,29H,3H2,1-2H3 |
| InChIKey | JLIRGWYIMGLWBA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 162614402 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162614402?
The IUPAC name of CID 162614402 (CID 162614402) is not available.
What is the SMILES notation for CID 162614402?
The canonical SMILES for CID 162614402 is CC[Si](O)c1ccc(Oc2ccc(F)cc2F)c(-c2cc(C(F)(F)F)c(=O)n(C)c2)c1.
What is the InChIKey of CID 162614402?
The InChIKey is JLIRGWYIMGLWBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17F5NO3Si/c1-3-31(29)14-5-7-18(30-19-6-4-13(22)9-17(19)23)15(10-14)12-8-16(21(24,25)26)20(28)27(2)11-12/h4-11,29H,3H2,1-2H3.
What are the key properties of CID 162614402?
CID 162614402 has a molecular weight of 454.45 g/mol, XLogP of 4.35, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162614402 is sourced from PubChem (CID 162614402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).