C11H12O7 — CID 137331662
[5-(2-methylprop-2-enoyloxy)-2-oxo-1,3-dioxolan-4-yl] 2-methylprop-2-enoate (PubChem CID 137331662) has the molecular formula C11H12O7 and a molecular weight of 256.21 g/mol. Its IUPAC name is [5-(2-methylprop-2-enoyloxy)-2-oxo-1,3-dioxolan-4-yl] 2-methylprop-2-enoate.
| Compound Name | [5-(2-methylprop-2-enoyloxy)-2-oxo-1,3-dioxolan-4-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 137331662 |
| Molecular Formula | C11H12O7 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | [5-(2-methylprop-2-enoyloxy)-2-oxo-1,3-dioxolan-4-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1OC(=O)OC1OC(=O)C(=C)C |
| InChI | InChI=1S/C11H12O7/c1-5(2)7(12)15-9-10(18-11(14)17-9)16-8(13)6(3)4/h9-10H,1,3H2,2,4H3 |
| InChIKey | SUWDVNXYERGNFJ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|