About 6-fluoro-7-methyl-[1,2,4]triazolo[1,5-a]pyridine
6-fluoro-7-methyl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 137332707) has the molecular formula C7H6FN3
and a molecular weight of 151.14 g/mol. Its IUPAC name is 6-fluoro-7-methyl-[1,2,4]triazolo[1,5-a]pyridine.
Analyze 6-fluoro-7-methyl-[1,2,4]triazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-7-methyl-[1,2,4]triazolo[1,5-a]pyridine?
The IUPAC name of 6-fluoro-7-methyl-[1,2,4]triazolo[1,5-a]pyridine (CID 137332707) is 6-fluoro-7-methyl-[1,2,4]triazolo[1,5-a]pyridine.
What is the SMILES notation for 6-fluoro-7-methyl-[1,2,4]triazolo[1,5-a]pyridine?
The canonical SMILES for 6-fluoro-7-methyl-[1,2,4]triazolo[1,5-a]pyridine is Cc1cc2ncnn2cc1F.
What is the InChIKey of 6-fluoro-7-methyl-[1,2,4]triazolo[1,5-a]pyridine?
The InChIKey is XHHNRIXAELWYRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6FN3/c1-5-2-7-9-4-10-11(7)3-6(5)8/h2-4H,1H3.
What are the key properties of 6-fluoro-7-methyl-[1,2,4]triazolo[1,5-a]pyridine?
6-fluoro-7-methyl-[1,2,4]triazolo[1,5-a]pyridine has a molecular weight of 151.14 g/mol, XLogP of 1.18, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-7-methyl-[1,2,4]triazolo[1,5-a]pyridine is sourced from PubChem (CID 137332707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).