C16H23N3O3 — CID 137335551
(3aR,7aR)-2-(2-methyl-5-propylpyrimidin-4-yl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid (PubChem CID 137335551) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is (3aR,7aR)-2-(2-methyl-5-propylpyrimidin-4-yl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid.
| Compound Name | (3aR,7aR)-2-(2-methyl-5-propylpyrimidin-4-yl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
|---|---|
| PubChem CID | 137335551 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | (3aR,7aR)-2-(2-methyl-5-propylpyrimidin-4-yl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
| SMILES | CCCc1cnc(C)nc1N1C[C@@H]2COCC[C@]2(C(=O)O)C1 |
| InChI | InChI=1S/C16H23N3O3/c1-3-4-12-7-17-11(2)18-14(12)19-8-13-9-22-6-5-16(13,10-19)15(20)21/h7,13H,3-6,8-10H2,1-2H3,(H,20,21)/t13-,16+/m1/s1 |
| InChIKey | KXBQDQBNNFDCTC-CJNGLKHVSA-N |
| XLogP | 1.67 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |