C16H17N3O3S — CID 137338545
(3aR,7aR)-2-(5-phenyl-1,3,4-thiadiazol-2-yl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid (PubChem CID 137338545) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is (3aR,7aR)-2-(5-phenyl-1,3,4-thiadiazol-2-yl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid.
| Compound Name | (3aR,7aR)-2-(5-phenyl-1,3,4-thiadiazol-2-yl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
|---|---|
| PubChem CID | 137338545 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | (3aR,7aR)-2-(5-phenyl-1,3,4-thiadiazol-2-yl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
| SMILES | O=C(O)[C@]12CCOC[C@H]1CN(c1nnc(-c3ccccc3)s1)C2 |
| InChI | InChI=1S/C16H17N3O3S/c20-14(21)16-6-7-22-9-12(16)8-19(10-16)15-18-17-13(23-15)11-4-2-1-3-5-11/h1-5,12H,6-10H2,(H,20,21)/t12-,16+/m1/s1 |
| InChIKey | QJIDSACXWOQQCB-WBMJQRKESA-N |
| XLogP | 2.13 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |