C14H18FN3O3 — CID 137340056
(3aR,7aR)-2-(6-ethyl-5-fluoropyrimidin-4-yl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid (PubChem CID 137340056) has the molecular formula C14H18FN3O3 and a molecular weight of 295.31 g/mol. Its IUPAC name is (3aR,7aR)-2-(6-ethyl-5-fluoropyrimidin-4-yl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid.
| Compound Name | (3aR,7aR)-2-(6-ethyl-5-fluoropyrimidin-4-yl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
|---|---|
| PubChem CID | 137340056 |
| Molecular Formula | C14H18FN3O3 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | (3aR,7aR)-2-(6-ethyl-5-fluoropyrimidin-4-yl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
| SMILES | CCc1ncnc(N2C[C@@H]3COCC[C@]3(C(=O)O)C2)c1F |
| InChI | InChI=1S/C14H18FN3O3/c1-2-10-11(15)12(17-8-16-10)18-5-9-6-21-4-3-14(9,7-18)13(19)20/h8-9H,2-7H2,1H3,(H,19,20)/t9-,14+/m1/s1 |
| InChIKey | PQUGSRVDENREJJ-OTYXRUKQSA-N |
| XLogP | 1.11 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |