C19H27N3O2 — CID 137338781
(3S,8aR)-2-[3-[4-(dimethylamino)phenyl]propanoyl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one (PubChem CID 137338781) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is (3S,8aR)-2-[3-[4-(dimethylamino)phenyl]propanoyl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one.
| Compound Name | (3S,8aR)-2-[3-[4-(dimethylamino)phenyl]propanoyl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
|---|---|
| PubChem CID | 137338781 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | (3S,8aR)-2-[3-[4-(dimethylamino)phenyl]propanoyl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
| SMILES | C[C@H]1C(=O)N2CCC[C@@H]2CN1C(=O)CCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H27N3O2/c1-14-19(24)21-12-4-5-17(21)13-22(14)18(23)11-8-15-6-9-16(10-7-15)20(2)3/h6-7,9-10,14,17H,4-5,8,11-13H2,1-3H3/t14-,17+/m0/s1 |
| InChIKey | OSGGRNJMLQQHJU-WMLDXEAASA-N |
| XLogP | 1.91 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|