C16H19FN4O4S — CID 137338887
5-fluoro-4-methoxy-2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]pyrimidine (PubChem CID 137338887) has the molecular formula C16H19FN4O4S and a molecular weight of 382.42 g/mol. Its IUPAC name is 5-fluoro-4-methoxy-2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]pyrimidine.
| Compound Name | 5-fluoro-4-methoxy-2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 137338887 |
| Molecular Formula | C16H19FN4O4S |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 5-fluoro-4-methoxy-2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]pyrimidine |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(c3ncc(F)c(OC)n3)CC2)cc1 |
| InChI | InChI=1S/C16H19FN4O4S/c1-24-12-3-5-13(6-4-12)26(22,23)21-9-7-20(8-10-21)16-18-11-14(17)15(19-16)25-2/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | SKJRPJSLQHFSAS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |