C16H23FN2O2 — CID 137339259
[5-[3-(4-fluorophenoxy)propyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol (PubChem CID 137339259) has the molecular formula C16H23FN2O2 and a molecular weight of 294.37 g/mol. Its IUPAC name is [5-[3-(4-fluorophenoxy)propyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol.
| Compound Name | [5-[3-(4-fluorophenoxy)propyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol |
|---|---|
| PubChem CID | 137339259 |
| Molecular Formula | C16H23FN2O2 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | [5-[3-(4-fluorophenoxy)propyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol |
| SMILES | OCC12CNCC1CN(CCCOc1ccc(F)cc1)C2 |
| InChI | InChI=1S/C16H23FN2O2/c17-14-2-4-15(5-3-14)21-7-1-6-19-9-13-8-18-10-16(13,11-19)12-20/h2-5,13,18,20H,1,6-12H2 |
| InChIKey | WRMMOBREASERSA-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|