C14H23NO3 — CID 137339427
2-(cyclopenten-1-yl)-1-[4-(1,2-dihydroxyethyl)piperidin-1-yl]ethanone (PubChem CID 137339427) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 2-(cyclopenten-1-yl)-1-[4-(1,2-dihydroxyethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-(cyclopenten-1-yl)-1-[4-(1,2-dihydroxyethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 137339427 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 2-(cyclopenten-1-yl)-1-[4-(1,2-dihydroxyethyl)piperidin-1-yl]ethanone |
| SMILES | O=C(CC1=CCCC1)N1CCC(C(O)CO)CC1 |
| InChI | InChI=1S/C14H23NO3/c16-10-13(17)12-5-7-15(8-6-12)14(18)9-11-3-1-2-4-11/h3,12-13,16-17H,1-2,4-10H2 |
| InChIKey | RKIPOSDLRTZGNF-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|