C21H31N3O — CID 137339495
(3S,8aS)-2-[1-(3,5-dimethylphenyl)piperidin-4-yl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one (PubChem CID 137339495) has the molecular formula C21H31N3O and a molecular weight of 341.50 g/mol. Its IUPAC name is (3S,8aS)-2-[1-(3,5-dimethylphenyl)piperidin-4-yl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one.
| Compound Name | (3S,8aS)-2-[1-(3,5-dimethylphenyl)piperidin-4-yl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
|---|---|
| PubChem CID | 137339495 |
| Molecular Formula | C21H31N3O |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | (3S,8aS)-2-[1-(3,5-dimethylphenyl)piperidin-4-yl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
| SMILES | Cc1cc(C)cc(N2CCC(N3C[C@@H]4CCCN4C(=O)[C@@H]3C)CC2)c1 |
| InChI | InChI=1S/C21H31N3O/c1-15-11-16(2)13-20(12-15)22-9-6-18(7-10-22)24-14-19-5-4-8-23(19)21(25)17(24)3/h11-13,17-19H,4-10,14H2,1-3H3/t17-,19-/m0/s1 |
| InChIKey | PRBAPUXZEZJTEM-HKUYNNGSSA-N |
| XLogP | 2.97 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |