C21H23N3O — CID 137340660
(6S)-6-benzyl-4-[2-(1H-indol-3-yl)ethyl]piperazin-2-one (PubChem CID 137340660) has the molecular formula C21H23N3O and a molecular weight of 333.44 g/mol. Its IUPAC name is (6S)-6-benzyl-4-[2-(1H-indol-3-yl)ethyl]piperazin-2-one.
| Compound Name | (6S)-6-benzyl-4-[2-(1H-indol-3-yl)ethyl]piperazin-2-one |
|---|---|
| PubChem CID | 137340660 |
| Molecular Formula | C21H23N3O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | (6S)-6-benzyl-4-[2-(1H-indol-3-yl)ethyl]piperazin-2-one |
| SMILES | O=C1CN(CCc2c[nH]c3ccccc23)C[C@H](Cc2ccccc2)N1 |
| InChI | InChI=1S/C21H23N3O/c25-21-15-24(14-18(23-21)12-16-6-2-1-3-7-16)11-10-17-13-22-20-9-5-4-8-19(17)20/h1-9,13,18,22H,10-12,14-15H2,(H,23,25)/t18-/m0/s1 |
| InChIKey | AVQMNHZPTMGNDZ-SFHVURJKSA-N |
| XLogP | 2.75 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |