C14H21N5O2 — CID 137341870
N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-5-(methoxymethyl)-N-methyl-1,3,4-oxadiazol-2-amine (PubChem CID 137341870) has the molecular formula C14H21N5O2 and a molecular weight of 291.36 g/mol. Its IUPAC name is N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-5-(methoxymethyl)-N-methyl-1,3,4-oxadiazol-2-amine.
| Compound Name | N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-5-(methoxymethyl)-N-methyl-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 137341870 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-5-(methoxymethyl)-N-methyl-1,3,4-oxadiazol-2-amine |
| SMILES | COCc1nnc(N(C)Cc2n[nH]c3c2CCCCC3)o1 |
| InChI | InChI=1S/C14H21N5O2/c1-19(14-18-17-13(21-14)9-20-2)8-12-10-6-4-3-5-7-11(10)15-16-12/h3-9H2,1-2H3,(H,15,16) |
| InChIKey | QKQLKOZPPKNHGZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 80.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |