C17H22ClN3O2 — CID 137342820
[(3aR,7aR)-2-[(4-chloro-1-methylindazol-3-yl)methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol (PubChem CID 137342820) has the molecular formula C17H22ClN3O2 and a molecular weight of 335.84 g/mol. Its IUPAC name is [(3aR,7aR)-2-[(4-chloro-1-methylindazol-3-yl)methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol.
| Compound Name | [(3aR,7aR)-2-[(4-chloro-1-methylindazol-3-yl)methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol |
|---|---|
| PubChem CID | 137342820 |
| Molecular Formula | C17H22ClN3O2 |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | [(3aR,7aR)-2-[(4-chloro-1-methylindazol-3-yl)methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol |
| SMILES | Cn1nc(CN2C[C@@H]3COCC[C@]3(CO)C2)c2c(Cl)cccc21 |
| InChI | InChI=1S/C17H22ClN3O2/c1-20-15-4-2-3-13(18)16(15)14(19-20)8-21-7-12-9-23-6-5-17(12,10-21)11-22/h2-4,12,22H,5-11H2,1H3/t12-,17-/m1/s1 |
| InChIKey | SWLFOWHJMAABRG-SJKOYZFVSA-N |
| XLogP | 2.06 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |