C11H17FN4O2S — CID 137344414
(2S)-2-[[4-(dimethylamino)-5-fluoropyrimidin-2-yl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 137344414) has the molecular formula C11H17FN4O2S and a molecular weight of 288.35 g/mol. Its IUPAC name is (2S)-2-[[4-(dimethylamino)-5-fluoropyrimidin-2-yl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[4-(dimethylamino)-5-fluoropyrimidin-2-yl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 137344414 |
| Molecular Formula | C11H17FN4O2S |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | (2S)-2-[[4-(dimethylamino)-5-fluoropyrimidin-2-yl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](Nc1ncc(F)c(N(C)C)n1)C(=O)O |
| InChI | InChI=1S/C11H17FN4O2S/c1-16(2)9-7(12)6-13-11(15-9)14-8(10(17)18)4-5-19-3/h6,8H,4-5H2,1-3H3,(H,17,18)(H,13,14,15)/t8-/m0/s1 |
| InChIKey | NIWBIGUBBWXQSA-QMMMGPOBSA-N |
| XLogP | 1.30 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |