C14H20FN3O2 — CID 137344472
9-(5-fluoro-4-methoxypyrimidin-2-yl)-3-oxa-9-azaspiro[5.5]undecane (PubChem CID 137344472) has the molecular formula C14H20FN3O2 and a molecular weight of 281.33 g/mol. Its IUPAC name is 9-(5-fluoro-4-methoxypyrimidin-2-yl)-3-oxa-9-azaspiro[5.5]undecane.
| Compound Name | 9-(5-fluoro-4-methoxypyrimidin-2-yl)-3-oxa-9-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 137344472 |
| Molecular Formula | C14H20FN3O2 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 9-(5-fluoro-4-methoxypyrimidin-2-yl)-3-oxa-9-azaspiro[5.5]undecane |
| SMILES | COc1nc(N2CCC3(CCOCC3)CC2)ncc1F |
| InChI | InChI=1S/C14H20FN3O2/c1-19-12-11(15)10-16-13(17-12)18-6-2-14(3-7-18)4-8-20-9-5-14/h10H,2-9H2,1H3 |
| InChIKey | WQDXOGPPZRJMNB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |