C14H22FN3O3 — CID 97135772
[(3S)-1-(5-fluoro-4-methoxypyrimidin-2-yl)-3-(2-methoxyethyl)piperidin-3-yl]methanol (PubChem CID 97135772) has the molecular formula C14H22FN3O3 and a molecular weight of 299.35 g/mol. Its IUPAC name is [(3S)-1-(5-fluoro-4-methoxypyrimidin-2-yl)-3-(2-methoxyethyl)piperidin-3-yl]methanol.
| Compound Name | [(3S)-1-(5-fluoro-4-methoxypyrimidin-2-yl)-3-(2-methoxyethyl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 97135772 |
| Molecular Formula | C14H22FN3O3 |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | [(3S)-1-(5-fluoro-4-methoxypyrimidin-2-yl)-3-(2-methoxyethyl)piperidin-3-yl]methanol |
| SMILES | COCC[C@@]1(CO)CCCN(c2ncc(F)c(OC)n2)C1 |
| InChI | InChI=1S/C14H22FN3O3/c1-20-7-5-14(10-19)4-3-6-18(9-14)13-16-8-11(15)12(17-13)21-2/h8,19H,3-7,9-10H2,1-2H3/t14-/m0/s1 |
| InChIKey | KRYYZMUOJRPZRX-AWEZNQCLSA-N |
| XLogP | 1.24 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |