C15H22FN3O4 — CID 86283122
1-(5-fluoro-4-methoxypyrimidin-2-yl)-3-(3-methoxypropyl)piperidine-3-carboxylic acid (PubChem CID 86283122) has the molecular formula C15H22FN3O4 and a molecular weight of 327.36 g/mol. Its IUPAC name is 1-(5-fluoro-4-methoxypyrimidin-2-yl)-3-(3-methoxypropyl)piperidine-3-carboxylic acid.
| Compound Name | 1-(5-fluoro-4-methoxypyrimidin-2-yl)-3-(3-methoxypropyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 86283122 |
| Molecular Formula | C15H22FN3O4 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-(5-fluoro-4-methoxypyrimidin-2-yl)-3-(3-methoxypropyl)piperidine-3-carboxylic acid |
| SMILES | COCCCC1(C(=O)O)CCCN(c2ncc(F)c(OC)n2)C1 |
| InChI | InChI=1S/C15H22FN3O4/c1-22-8-4-6-15(13(20)21)5-3-7-19(10-15)14-17-9-11(16)12(18-14)23-2/h9H,3-8,10H2,1-2H3,(H,20,21) |
| InChIKey | MWRXFOIDLJDRJU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|