C15H23FN4O3 — CID 72915601
1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-3-(3-methoxypropyl)piperidine-3-carboxylic acid (PubChem CID 72915601) has the molecular formula C15H23FN4O3 and a molecular weight of 326.37 g/mol. Its IUPAC name is 1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-3-(3-methoxypropyl)piperidine-3-carboxylic acid.
| Compound Name | 1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-3-(3-methoxypropyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 72915601 |
| Molecular Formula | C15H23FN4O3 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-3-(3-methoxypropyl)piperidine-3-carboxylic acid |
| SMILES | CNc1nc(N2CCCC(CCCOC)(C(=O)O)C2)ncc1F |
| InChI | InChI=1S/C15H23FN4O3/c1-17-12-11(16)9-18-14(19-12)20-7-3-5-15(10-20,13(21)22)6-4-8-23-2/h9H,3-8,10H2,1-2H3,(H,21,22)(H,17,18,19) |
| InChIKey | YICHOWUSQCKIIH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|