C14H21FN4O3 — CID 72872904
1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid (PubChem CID 72872904) has the molecular formula C14H21FN4O3 and a molecular weight of 312.35 g/mol. Its IUPAC name is 1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid.
| Compound Name | 1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 72872904 |
| Molecular Formula | C14H21FN4O3 |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid |
| SMILES | CNc1nc(N2CCCC(CCOC)(C(=O)O)C2)ncc1F |
| InChI | InChI=1S/C14H21FN4O3/c1-16-11-10(15)8-17-13(18-11)19-6-3-4-14(9-19,12(20)21)5-7-22-2/h8H,3-7,9H2,1-2H3,(H,20,21)(H,16,17,18) |
| InChIKey | BGXDFQCZCARYPM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |