C18H23N5O2S — CID 137344997
1-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-3-carbonyl)-1,4-diazepan-1-yl]-2-thiophen-2-ylethanone (PubChem CID 137344997) has the molecular formula C18H23N5O2S and a molecular weight of 373.48 g/mol. Its IUPAC name is 1-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-3-carbonyl)-1,4-diazepan-1-yl]-2-thiophen-2-ylethanone.
| Compound Name | 1-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-3-carbonyl)-1,4-diazepan-1-yl]-2-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 137344997 |
| Molecular Formula | C18H23N5O2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 1-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-3-carbonyl)-1,4-diazepan-1-yl]-2-thiophen-2-ylethanone |
| SMILES | O=C(Cc1cccs1)N1CCCN(C(=O)c2nnc3n2CCCC3)CC1 |
| InChI | InChI=1S/C18H23N5O2S/c24-16(13-14-5-3-12-26-14)21-7-4-8-22(11-10-21)18(25)17-20-19-15-6-1-2-9-23(15)17/h3,5,12H,1-2,4,6-11,13H2 |
| InChIKey | NYYZNFIPYOZZLI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |