C12H13FN2O2 — CID 137347286
tert-butyl 6-fluoroimidazo[1,2-a]pyridine-2-carboxylate (PubChem CID 137347286) has the molecular formula C12H13FN2O2 and a molecular weight of 236.25 g/mol. Its IUPAC name is tert-butyl 6-fluoroimidazo[1,2-a]pyridine-2-carboxylate.
| Compound Name | tert-butyl 6-fluoroimidazo[1,2-a]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 137347286 |
| Molecular Formula | C12H13FN2O2 |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | tert-butyl 6-fluoroimidazo[1,2-a]pyridine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cn2cc(F)ccc2n1 |
| InChI | InChI=1S/C12H13FN2O2/c1-12(2,3)17-11(16)9-7-15-6-8(13)4-5-10(15)14-9/h4-7H,1-3H3 |
| InChIKey | KVLPCHNTWZXLTL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |