C9H10FN3O — CID 143999441
6-fluoro-2-methylimidazo[1,2-a]pyridine;formamide (PubChem CID 143999441) has the molecular formula C9H10FN3O and a molecular weight of 195.20 g/mol. Its IUPAC name is 6-fluoro-2-methylimidazo[1,2-a]pyridine;formamide.
| Compound Name | 6-fluoro-2-methylimidazo[1,2-a]pyridine;formamide |
|---|---|
| PubChem CID | 143999441 |
| Molecular Formula | C9H10FN3O |
| Molecular Weight | 195.20 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 6-fluoro-2-methylimidazo[1,2-a]pyridine;formamide |
| SMILES | Cc1cn2cc(F)ccc2n1.NC=O |
| InChI | InChI=1S/C8H7FN2.CH3NO/c1-6-4-11-5-7(9)2-3-8(11)10-6;2-1-3/h2-5H,1H3;1H,(H2,2,3) |
| InChIKey | CUSBNACASATZKA-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.20 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|