C10H13N3O — CID 83829797
2-amino-1-(2-methylimidazo[1,2-a]pyridin-6-yl)ethanol (PubChem CID 83829797) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-amino-1-(2-methylimidazo[1,2-a]pyridin-6-yl)ethanol.
| Compound Name | 2-amino-1-(2-methylimidazo[1,2-a]pyridin-6-yl)ethanol |
|---|---|
| PubChem CID | 83829797 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 2-amino-1-(2-methylimidazo[1,2-a]pyridin-6-yl)ethanol |
| SMILES | Cc1cn2cc(C(O)CN)ccc2n1 |
| InChI | InChI=1S/C10H13N3O/c1-7-5-13-6-8(9(14)4-11)2-3-10(13)12-7/h2-3,5-6,9,14H,4,11H2,1H3 |
| InChIKey | BYFRMBXRAANQNL-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 63.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |