C13H18BrNO2 — CID 137347431
propan-2-yl 3-bromo-2,3,5,6,7,8-hexahydroisoquinoline-4-carboxylate (PubChem CID 137347431) has the molecular formula C13H18BrNO2 and a molecular weight of 300.20 g/mol. Its IUPAC name is propan-2-yl 3-bromo-2,3,5,6,7,8-hexahydroisoquinoline-4-carboxylate.
| Compound Name | propan-2-yl 3-bromo-2,3,5,6,7,8-hexahydroisoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 137347431 |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | propan-2-yl 3-bromo-2,3,5,6,7,8-hexahydroisoquinoline-4-carboxylate |
| SMILES | CC(C)OC(=O)C1=C2CCCCC2=CNC1Br |
| InChI | InChI=1S/C13H18BrNO2/c1-8(2)17-13(16)11-10-6-4-3-5-9(10)7-15-12(11)14/h7-8,12,15H,3-6H2,1-2H3 |
| InChIKey | HWKBYABUGIJQRO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|