C14H20BrNO2 — CID 137347478
tert-butyl 3-bromo-2,3,5,6,7,8-hexahydroisoquinoline-4-carboxylate (PubChem CID 137347478) has the molecular formula C14H20BrNO2 and a molecular weight of 314.22 g/mol. Its IUPAC name is tert-butyl 3-bromo-2,3,5,6,7,8-hexahydroisoquinoline-4-carboxylate.
| Compound Name | tert-butyl 3-bromo-2,3,5,6,7,8-hexahydroisoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 137347478 |
| Molecular Formula | C14H20BrNO2 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | tert-butyl 3-bromo-2,3,5,6,7,8-hexahydroisoquinoline-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1=C2CCCCC2=CNC1Br |
| InChI | InChI=1S/C14H20BrNO2/c1-14(2,3)18-13(17)11-10-7-5-4-6-9(10)8-16-12(11)15/h8,12,16H,4-7H2,1-3H3 |
| InChIKey | KTQBQIFEQPIZRA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|