C14H15ClN2O2S — CID 137347513
5-chloro-2-[(4-morpholin-4-ylphenyl)methyl]-1,2-thiazol-3-one (PubChem CID 137347513) has the molecular formula C14H15ClN2O2S and a molecular weight of 310.81 g/mol. Its IUPAC name is 5-chloro-2-[(4-morpholin-4-ylphenyl)methyl]-1,2-thiazol-3-one.
| Compound Name | 5-chloro-2-[(4-morpholin-4-ylphenyl)methyl]-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 137347513 |
| Molecular Formula | C14H15ClN2O2S |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 5-chloro-2-[(4-morpholin-4-ylphenyl)methyl]-1,2-thiazol-3-one |
| SMILES | O=c1cc(Cl)sn1Cc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C14H15ClN2O2S/c15-13-9-14(18)17(20-13)10-11-1-3-12(4-2-11)16-5-7-19-8-6-16/h1-4,9H,5-8,10H2 |
| InChIKey | DMORQOYDEDLOKC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|