C10H21NO3 — CID 137347972
(2R,4S,5S)-5-amino-4-hydroxy-2,7-dimethyloctanoic acid (PubChem CID 137347972) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is (2R,4S,5S)-5-amino-4-hydroxy-2,7-dimethyloctanoic acid.
| Compound Name | (2R,4S,5S)-5-amino-4-hydroxy-2,7-dimethyloctanoic acid |
|---|---|
| PubChem CID | 137347972 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | (2R,4S,5S)-5-amino-4-hydroxy-2,7-dimethyloctanoic acid |
| SMILES | CC(C)C[C@H](N)[C@@H](O)C[C@@H](C)C(=O)O |
| InChI | InChI=1S/C10H21NO3/c1-6(2)4-8(11)9(12)5-7(3)10(13)14/h6-9,12H,4-5,11H2,1-3H3,(H,13,14)/t7-,8+,9+/m1/s1 |
| InChIKey | PUJHJAZUGUEBOU-VGMNWLOBSA-N |
| XLogP | 0.83 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |