C39H76O5 — CID 137348186
(Z,1R)-1-[(2S)-3-hydroxy-2-[(E,1S)-1-hydroxyoctadec-8-enoxy]propoxy]octadec-8-en-1-ol (PubChem CID 137348186) has the molecular formula C39H76O5 and a molecular weight of 625.03 g/mol. Its IUPAC name is (Z,1R)-1-[(2S)-3-hydroxy-2-[(E,1S)-1-hydroxyoctadec-8-enoxy]propoxy]octadec-8-en-1-ol.
| Compound Name | (Z,1R)-1-[(2S)-3-hydroxy-2-[(E,1S)-1-hydroxyoctadec-8-enoxy]propoxy]octadec-8-en-1-ol |
|---|---|
| PubChem CID | 137348186 |
| Molecular Formula | C39H76O5 |
| Molecular Weight | 625.03 g/mol |
| Exact Mass | 624.57 |
| IUPAC Name | (Z,1R)-1-[(2S)-3-hydroxy-2-[(E,1S)-1-hydroxyoctadec-8-enoxy]propoxy]octadec-8-en-1-ol |
| SMILES | CCCCCCCCC/C=C\CCCCCC[C@H](O)OC[C@H](CO)O[C@H](O)CCCCCC/C=C/CCCCCCCCC |
| InChI | InChI=1S/C39H76O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(41)43-36-37(35-40)44-39(42)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h19-22,37-42H,3-18,23-36H2,1-2H3/b21-19-,22-20+/t37-,38+,39-/m0/s1 |
| InChIKey | OBURSNHVDFVKSA-YKKXEANNSA-N |
| XLogP | 11.09 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.03 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|