C33H20N4O2Zn-2 — CID 137348805
4-(15-phenylporphyrin-22,24-diid-5-yl)benzoic acid;zinc (PubChem CID 137348805) has the molecular formula C33H20N4O2Zn-2 and a molecular weight of 569.94 g/mol. Its IUPAC name is 4-(15-phenylporphyrin-22,24-diid-5-yl)benzoic acid;zinc.
| Compound Name | 4-(15-phenylporphyrin-22,24-diid-5-yl)benzoic acid;zinc |
|---|---|
| PubChem CID | 137348805 |
| Molecular Formula | C33H20N4O2Zn-2 |
| Molecular Weight | 569.94 g/mol |
| Exact Mass | 568.09 |
| IUPAC Name | 4-(15-phenylporphyrin-22,24-diid-5-yl)benzoic acid;zinc |
| SMILES | O=C(O)c1ccc(-c2c3nc(cc4ccc([n-]4)c(-c4ccccc4)c4nc(cc5ccc2[n-]5)C=C4)C=C3)cc1.[Zn] |
| InChI | InChI=1S/C33H21N4O2.Zn/c38-33(39)22-8-6-21(7-9-22)32-29-16-12-25(36-29)18-23-10-14-27(34-23)31(20-4-2-1-3-5-20)28-15-11-24(35-28)19-26-13-17-30(32)37-26;/h1-19H,(H2-,34,35,36,37,38,39);/q-1;/p-1/b23-18-,24-19-,25-18-,26-19-,31-27-,31-28-,32-29-,32-30-; |
| InChIKey | ZQWVUSSZQHSCII-LTTHWXANSA-M |
| XLogP | 6.94 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.94 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|