C21H28N2 — CID 137351962
1,2-dibenzyl-4-methylcyclohexane-1,4-diamine (PubChem CID 137351962) has the molecular formula C21H28N2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 1,2-dibenzyl-4-methylcyclohexane-1,4-diamine.
| Compound Name | 1,2-dibenzyl-4-methylcyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 137351962 |
| Molecular Formula | C21H28N2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 1,2-dibenzyl-4-methylcyclohexane-1,4-diamine |
| SMILES | CC1(N)CCC(N)(Cc2ccccc2)C(Cc2ccccc2)C1 |
| InChI | InChI=1S/C21H28N2/c1-20(22)12-13-21(23,15-18-10-6-3-7-11-18)19(16-20)14-17-8-4-2-5-9-17/h2-11,19H,12-16,22-23H2,1H3 |
| InChIKey | HVHJIJBIKALNMX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |