C30H34F4N4 — CID 137352231
4-[2-(2,6-diethylphenyl)-6,6-dimethyl-5-(3,3,3-trifluoro-2,2-dimethylpropyl)-4H-pyrrolo[3,4-c]pyrazol-3-yl]-7-fluoro-1H-indole (PubChem CID 137352231) has the molecular formula C30H34F4N4 and a molecular weight of 526.62 g/mol. Its IUPAC name is 4-[2-(2,6-diethylphenyl)-6,6-dimethyl-5-(3,3,3-trifluoro-2,2-dimethylpropyl)-4H-pyrrolo[3,4-c]pyrazol-3-yl]-7-fluoro-1H-indole.
| Compound Name | 4-[2-(2,6-diethylphenyl)-6,6-dimethyl-5-(3,3,3-trifluoro-2,2-dimethylpropyl)-4H-pyrrolo[3,4-c]pyrazol-3-yl]-7-fluoro-1H-indole |
|---|---|
| PubChem CID | 137352231 |
| Molecular Formula | C30H34F4N4 |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | 4-[2-(2,6-diethylphenyl)-6,6-dimethyl-5-(3,3,3-trifluoro-2,2-dimethylpropyl)-4H-pyrrolo[3,4-c]pyrazol-3-yl]-7-fluoro-1H-indole |
| SMILES | CCc1cccc(CC)c1-n1nc2c(c1-c1ccc(F)c3[nH]ccc13)CN(CC(C)(C)C(F)(F)F)C2(C)C |
| InChI | InChI=1S/C30H34F4N4/c1-7-18-10-9-11-19(8-2)25(18)38-26(21-12-13-23(31)24-20(21)14-15-35-24)22-16-37(29(5,6)27(22)36-38)17-28(3,4)30(32,33)34/h9-15,35H,7-8,16-17H2,1-6H3 |
| InChIKey | HDSDBJXEYYCOOC-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |