C25H30F4N6 — CID 142509033
N-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]-6-[(6S,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]pyridin-3-amine (PubChem CID 142509033) has the molecular formula C25H30F4N6 and a molecular weight of 490.55 g/mol. Its IUPAC name is N-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]-6-[(6S,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]pyridin-3-amine.
| Compound Name | N-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]-6-[(6S,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 142509033 |
| Molecular Formula | C25H30F4N6 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | N-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]-6-[(6S,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]pyridin-3-amine |
| SMILES | C[C@@H]1Cc2c(ccc3[nH]ncc23)[C@@H](c2ccc(N[C@H]3CCN(CCCF)C3)cn2)N1CC(F)(F)F |
| InChI | InChI=1S/C25H30F4N6/c1-16-11-20-19(4-6-22-21(20)13-31-33-22)24(35(16)15-25(27,28)29)23-5-3-17(12-30-23)32-18-7-10-34(14-18)9-2-8-26/h3-6,12-13,16,18,24,32H,2,7-11,14-15H2,1H3,(H,31,33)/t16-,18+,24+/m1/s1 |
| InChIKey | SLZOGJZVWHWZJT-YLNUKYHNSA-N |
| XLogP | 4.70 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |