C17H18N2O5S — CID 137353879
N-[4-[(2,5-dimethoxyphenyl)sulfamoyl]phenyl]prop-2-enamide (PubChem CID 137353879) has the molecular formula C17H18N2O5S and a molecular weight of 362.41 g/mol. Its IUPAC name is N-[4-[(2,5-dimethoxyphenyl)sulfamoyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[(2,5-dimethoxyphenyl)sulfamoyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 137353879 |
| Molecular Formula | C17H18N2O5S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | N-[4-[(2,5-dimethoxyphenyl)sulfamoyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(S(=O)(=O)Nc2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C17H18N2O5S/c1-4-17(20)18-12-5-8-14(9-6-12)25(21,22)19-15-11-13(23-2)7-10-16(15)24-3/h4-11,19H,1H2,2-3H3,(H,18,20) |
| InChIKey | SOXPERSPXCYAKB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|