C16H18N2O5S — CID 1118248
N-[4-[(2,4-dimethoxyphenyl)sulfamoyl]phenyl]acetamide (PubChem CID 1118248) has the molecular formula C16H18N2O5S and a molecular weight of 350.40 g/mol. Its IUPAC name is N-[4-[(2,4-dimethoxyphenyl)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[(2,4-dimethoxyphenyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 1118248 |
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | N-[4-[(2,4-dimethoxyphenyl)sulfamoyl]phenyl]acetamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(NC(C)=O)cc2)c(OC)c1 |
| InChI | InChI=1S/C16H18N2O5S/c1-11(19)17-12-4-7-14(8-5-12)24(20,21)18-15-9-6-13(22-2)10-16(15)23-3/h4-10,18H,1-3H3,(H,17,19) |
| InChIKey | PTXXDAMWJSDSIF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |